Organometallic Compounds
Filtered Search Results
Tris(trimethylsilyl) borate
CAS: 4325-85-3 Molecular Formula: C9H27BO3Si3 Molecular Weight (g/mol): 278.38 MDL Number: MFCD00051588 InChI Key: YZYKZHPNRDIPFA-UHFFFAOYSA-N Synonym: tris trimethylsilyl borate,tris trimethylsiloxy boron,silanol, trimethyl-, triester with boric acid h3bo3,tritrimethylsilyl borate,borane, tris trimethylsiloxy,silanol, 1,1,1-trimethyl-, 1,1',1-triester with boric acid h3bo3,acmc-209jtk,tris trimethylsiloxy borane,boric acid, 3tms derivative PubChem CID: 78020 IUPAC Name: tris(trimethylsilyl) borate SMILES: B(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C
| PubChem CID | 78020 |
|---|---|
| CAS | 4325-85-3 |
| Molecular Weight (g/mol) | 278.38 |
| MDL Number | MFCD00051588 |
| SMILES | B(O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| Synonym | tris trimethylsilyl borate,tris trimethylsiloxy boron,silanol, trimethyl-, triester with boric acid h3bo3,tritrimethylsilyl borate,borane, tris trimethylsiloxy,silanol, 1,1,1-trimethyl-, 1,1',1-triester with boric acid h3bo3,acmc-209jtk,tris trimethylsiloxy borane,boric acid, 3tms derivative |
| IUPAC Name | tris(trimethylsilyl) borate |
| InChI Key | YZYKZHPNRDIPFA-UHFFFAOYSA-N |
| Molecular Formula | C9H27BO3Si3 |
Tributylphenyltin
CAS: 960-16-7 Molecular Formula: C18H32Sn Molecular Weight (g/mol): 367.16 MDL Number: MFCD00134394 InChI Key: SYUVAXDZVWPKSI-UHFFFAOYSA-N Synonym: tributyl phenyl stannane,tributylphenyltin,phenyltributylstannane,stannane, tributylphenyl,phenyltributyltin,phenyltri-n-butyltin,phenyltributlytin,tributylphenyl tin,phenyl tnbutyl tin,phenyl tributyl tin PubChem CID: 607632 IUPAC Name: tributyl(phenyl)stannane SMILES: CCCC[Sn](CCCC)(CCCC)C1=CC=CC=C1
| PubChem CID | 607632 |
|---|---|
| CAS | 960-16-7 |
| Molecular Weight (g/mol) | 367.16 |
| MDL Number | MFCD00134394 |
| SMILES | CCCC[Sn](CCCC)(CCCC)C1=CC=CC=C1 |
| Synonym | tributyl phenyl stannane,tributylphenyltin,phenyltributylstannane,stannane, tributylphenyl,phenyltributyltin,phenyltri-n-butyltin,phenyltributlytin,tributylphenyl tin,phenyl tnbutyl tin,phenyl tributyl tin |
| IUPAC Name | tributyl(phenyl)stannane |
| InChI Key | SYUVAXDZVWPKSI-UHFFFAOYSA-N |
| Molecular Formula | C18H32Sn |
Tetrakis(trimethylsilyl)silane, 97%
CAS: 4098-98-0 Molecular Formula: C12H36Si5 Molecular Weight (g/mol): 320.85 MDL Number: MFCD00054859 InChI Key: BOJSDHZZKKYWAS-UHFFFAOYSA-N Synonym: tetrakis trimethylsilyl silane,1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl trisilane,tetrakil trimethylsilyl silane,si si ch3 3 4,trisilane, 1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl,2,2-bis trimethylsilyl-1,1,1,3,3,3-hexamethyl-trisilane,acmc-1an6g,tetra trimethylsilyl-silane,bojsdhzzkkywas-uhfffaoysa PubChem CID: 138115 IUPAC Name: tetrakis(trimethylsilyl)silane SMILES: C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C
| PubChem CID | 138115 |
|---|---|
| CAS | 4098-98-0 |
| Molecular Weight (g/mol) | 320.85 |
| MDL Number | MFCD00054859 |
| SMILES | C[Si](C)(C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| Synonym | tetrakis trimethylsilyl silane,1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl trisilane,tetrakil trimethylsilyl silane,si si ch3 3 4,trisilane, 1,1,1,3,3,3-hexamethyl-2,2-bis trimethylsilyl,2,2-bis trimethylsilyl-1,1,1,3,3,3-hexamethyl-trisilane,acmc-1an6g,tetra trimethylsilyl-silane,bojsdhzzkkywas-uhfffaoysa |
| IUPAC Name | tetrakis(trimethylsilyl)silane |
| InChI Key | BOJSDHZZKKYWAS-UHFFFAOYSA-N |
| Molecular Formula | C12H36Si5 |
Dimethylvinylchlorosilane, 97%
CAS: 1719-58-0 Molecular Formula: C4H8ClSi Molecular Weight (g/mol): 119.64 MDL Number: MFCD00018090 InChI Key: RABBDIBWJVOAPB-ONEGZZNKSA-N Synonym: chlorodimethylvinylsilane,dimethylvinylchlorosilane,vinyldimethylchlorosilane,chloro dimethyl vinylsilane,silane, chloroethenyldimethyl,chlorodimethyl vinyl silane,unii-xja6n5221t,chloroethenyldimethyl-silane,chloro ethenyl dimethylsilane,chloro-dimethyl-ethenyl-silane PubChem CID: 519368 IUPAC Name: chloro-ethenyl-dimethylsilane SMILES: C[Si](C)\C=C\Cl
| PubChem CID | 519368 |
|---|---|
| CAS | 1719-58-0 |
| Molecular Weight (g/mol) | 119.64 |
| MDL Number | MFCD00018090 |
| SMILES | C[Si](C)\C=C\Cl |
| Synonym | chlorodimethylvinylsilane,dimethylvinylchlorosilane,vinyldimethylchlorosilane,chloro dimethyl vinylsilane,silane, chloroethenyldimethyl,chlorodimethyl vinyl silane,unii-xja6n5221t,chloroethenyldimethyl-silane,chloro ethenyl dimethylsilane,chloro-dimethyl-ethenyl-silane |
| IUPAC Name | chloro-ethenyl-dimethylsilane |
| InChI Key | RABBDIBWJVOAPB-ONEGZZNKSA-N |
| Molecular Formula | C4H8ClSi |
Dimethoxydimethylsilane, 95+%, AcroSeal™
CAS: 1112-39-6 Molecular Formula: C4H12O2Si Molecular Weight (g/mol): 120.22 MDL Number: MFCD00025691 InChI Key: JJQZDUKDJDQPMQ-UHFFFAOYSA-N Synonym: dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane PubChem CID: 66187 IUPAC Name: dimethoxydimethylsilane SMILES: CO[Si](C)(C)OC
| PubChem CID | 66187 |
|---|---|
| CAS | 1112-39-6 |
| Molecular Weight (g/mol) | 120.22 |
| MDL Number | MFCD00025691 |
| SMILES | CO[Si](C)(C)OC |
| Synonym | dimethyldimethoxysilane,silane, dimethoxydimethyl,kbm 22,unii-a3qdb1rs1c,dimethyl dimethoxysilane,dimethoxy dimethyl silane,a3qdb1rs1c,dimethoxy-dimethylsilane,dimethyl dimethoxy silane,dimethyl dimethoxy silicane |
| IUPAC Name | dimethoxydimethylsilane |
| InChI Key | JJQZDUKDJDQPMQ-UHFFFAOYSA-N |
| Molecular Formula | C4H12O2Si |
Hexamethyldisilane, 98+%
CAS: 1450-14-2 Molecular Formula: C6H18Si2 Molecular Weight (g/mol): 146.38 MDL Number: MFCD00008258 InChI Key: NEXSMEBSBIABKL-UHFFFAOYSA-N Synonym: hexamethyldisilane,disilane, hexamethyl,permethyldisilane,disilane, 1,1,1,2,2,2-hexamethyl,1,1,1,2,2,2-hexamethyldisilane,trimethyl trimethylsilyl silane,ch3 6si2,hecamethyldisilane,disilane m6,hexamethyl disilane PubChem CID: 74057 IUPAC Name: trimethyl(trimethylsilyl)silane SMILES: C[Si](C)(C)[Si](C)(C)C
| PubChem CID | 74057 |
|---|---|
| CAS | 1450-14-2 |
| Molecular Weight (g/mol) | 146.38 |
| MDL Number | MFCD00008258 |
| SMILES | C[Si](C)(C)[Si](C)(C)C |
| Synonym | hexamethyldisilane,disilane, hexamethyl,permethyldisilane,disilane, 1,1,1,2,2,2-hexamethyl,1,1,1,2,2,2-hexamethyldisilane,trimethyl trimethylsilyl silane,ch3 6si2,hecamethyldisilane,disilane m6,hexamethyl disilane |
| IUPAC Name | trimethyl(trimethylsilyl)silane |
| InChI Key | NEXSMEBSBIABKL-UHFFFAOYSA-N |
| Molecular Formula | C6H18Si2 |
Potassium antimonyl tartrate trihydrate, ACS reagent
CAS: 28300-74-5 Molecular Formula: 1·5 H2O Molecular Weight (g/mol): 333.93 Synonym: Antimonyl potassium tartrate sesquihydrate
| CAS | 28300-74-5 |
|---|---|
| Molecular Weight (g/mol) | 333.93 |
| Synonym | Antimonyl potassium tartrate sesquihydrate |
| Molecular Formula | 1·5 H2O |
Chlorotriisopropylsilane, 97%
CAS: 13154-24-0 Molecular Formula: C9H21ClSi Molecular Weight (g/mol): 192.80 MDL Number: MFCD00009656 InChI Key: KQIADDMXRMTWHZ-UHFFFAOYSA-N Synonym: triisopropylsilyl chloride,chlorotriisopropylsilane,triisopropylchlorosilane,chlorotris propan-2-yl silane,chloro triisopropyl silane,silane, chlorotris 1-methylethyl,tipscl,triisopropylsilylchloride,triisopropyl chlorosilane,triisopropylchlorosilane, redistilled PubChem CID: 139400 SMILES: CC(C)[Si](Cl)(C(C)C)C(C)C
| PubChem CID | 139400 |
|---|---|
| CAS | 13154-24-0 |
| Molecular Weight (g/mol) | 192.80 |
| MDL Number | MFCD00009656 |
| SMILES | CC(C)[Si](Cl)(C(C)C)C(C)C |
| Synonym | triisopropylsilyl chloride,chlorotriisopropylsilane,triisopropylchlorosilane,chlorotris propan-2-yl silane,chloro triisopropyl silane,silane, chlorotris 1-methylethyl,tipscl,triisopropylsilylchloride,triisopropyl chlorosilane,triisopropylchlorosilane, redistilled |
| InChI Key | KQIADDMXRMTWHZ-UHFFFAOYSA-N |
| Molecular Formula | C9H21ClSi |
N,N-Dimethyltrimethylsilylamine, 97%
CAS: 2083-91-2 Molecular Formula: C5H15NSi Molecular Weight (g/mol): 117.27 MDL Number: MFCD00008297 InChI Key: KAHVZNKZQFSBFW-UHFFFAOYSA-N Synonym: n,n-dimethyltrimethylsilylamine,n,n-dimethylaminotrimethylsilane,silanamine, pentamethyl,dimethylamino trimethylsilane,pentamethylsilylamine,n-trimethylsilyl dimethylamine,tmsdma,dimethylaminotrimethylsilane,silanamine, n,n,1,1,1-pentamethyl,n,n-dimethyltrimethylsilamine PubChem CID: 74965 IUPAC Name: N-methyl-N-trimethylsilylmethanamine SMILES: CN(C)[Si](C)(C)C
| PubChem CID | 74965 |
|---|---|
| CAS | 2083-91-2 |
| Molecular Weight (g/mol) | 117.27 |
| MDL Number | MFCD00008297 |
| SMILES | CN(C)[Si](C)(C)C |
| Synonym | n,n-dimethyltrimethylsilylamine,n,n-dimethylaminotrimethylsilane,silanamine, pentamethyl,dimethylamino trimethylsilane,pentamethylsilylamine,n-trimethylsilyl dimethylamine,tmsdma,dimethylaminotrimethylsilane,silanamine, n,n,1,1,1-pentamethyl,n,n-dimethyltrimethylsilamine |
| IUPAC Name | N-methyl-N-trimethylsilylmethanamine |
| InChI Key | KAHVZNKZQFSBFW-UHFFFAOYSA-N |
| Molecular Formula | C5H15NSi |
Isopropyldimethylchlorosilane, 95%
CAS: 3634-56-8 Molecular Formula: C5H13ClSi Molecular Weight (g/mol): 136.69 MDL Number: MFCD00009917 InChI Key: YCXVDEMHEKQQCI-UHFFFAOYSA-N Synonym: isopropyldimethylchlorosilane,dimethylisopropylchlorosilane,chloro isopropyl dimethylsilane,chloro dimethyl isopropylsilane,chlorodimethylisopropylsilane,silane,chlorodimethyl 1-methylethyl,silane, chlorodimethyl 1-methylethyl,dmipscl,acmc-1bn7i,chlorodimethyl isopropylsilane PubChem CID: 5102883 IUPAC Name: chloro-dimethyl-propan-2-ylsilane SMILES: CC(C)[Si](C)(C)Cl
| PubChem CID | 5102883 |
|---|---|
| CAS | 3634-56-8 |
| Molecular Weight (g/mol) | 136.69 |
| MDL Number | MFCD00009917 |
| SMILES | CC(C)[Si](C)(C)Cl |
| Synonym | isopropyldimethylchlorosilane,dimethylisopropylchlorosilane,chloro isopropyl dimethylsilane,chloro dimethyl isopropylsilane,chlorodimethylisopropylsilane,silane,chlorodimethyl 1-methylethyl,silane, chlorodimethyl 1-methylethyl,dmipscl,acmc-1bn7i,chlorodimethyl isopropylsilane |
| IUPAC Name | chloro-dimethyl-propan-2-ylsilane |
| InChI Key | YCXVDEMHEKQQCI-UHFFFAOYSA-N |
| Molecular Formula | C5H13ClSi |
2-Phenylethyl-1-boronic acid pinacol ester, 99%
CAS: 165904-22-3 Molecular Formula: C14H21BO2 Molecular Weight (g/mol): 232.13 MDL Number: MFCD03788721 InChI Key: LVLQNRWCBBIVHR-UHFFFAOYSA-N Synonym: 4,4,5,5-tetramethyl-2-phenethyl-1,3,2-dioxaborolane,2-phenylethyl-1-boronic acid pinacol ester,4,4,5,5-tetramethyl-2-2-phenylethyl-1,3,2-dioxaborolane,2-phenylethylboronic acid, pinacol ester,phenethylboronic acid pinacol ester,2-phenylethylboronic acid pinacol ester,2-phenylethylboronic acid,pinacol ester,2-phenylethyl boronic acid pinacol ester,2-phenyl ethyl-1-boronic acid pinacol ester,2-phenethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane PubChem CID: 11333720 IUPAC Name: 4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane SMILES: B1(OC(C(O1)(C)C)(C)C)CCC2=CC=CC=C2
| PubChem CID | 11333720 |
|---|---|
| CAS | 165904-22-3 |
| Molecular Weight (g/mol) | 232.13 |
| MDL Number | MFCD03788721 |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CCC2=CC=CC=C2 |
| Synonym | 4,4,5,5-tetramethyl-2-phenethyl-1,3,2-dioxaborolane,2-phenylethyl-1-boronic acid pinacol ester,4,4,5,5-tetramethyl-2-2-phenylethyl-1,3,2-dioxaborolane,2-phenylethylboronic acid, pinacol ester,phenethylboronic acid pinacol ester,2-phenylethylboronic acid pinacol ester,2-phenylethylboronic acid,pinacol ester,2-phenylethyl boronic acid pinacol ester,2-phenyl ethyl-1-boronic acid pinacol ester,2-phenethyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(2-phenylethyl)-1,3,2-dioxaborolane |
| InChI Key | LVLQNRWCBBIVHR-UHFFFAOYSA-N |
| Molecular Formula | C14H21BO2 |
Lithium niobium methoxide, 99+% (metals basis), 5% w/v in methanol
CAS: 21864-11-9 MDL Number: MFCD00210627 Synonym: lithium niobium methoxide
| CAS | 21864-11-9 |
|---|---|
| MDL Number | MFCD00210627 |
| Synonym | lithium niobium methoxide |
| CAS | 12001-85-3 |
|---|---|
| MDL Number | MFCD00147699 |
Triethoxyvinylsilane, 97%, Thermo Scientific Chemicals
CAS: 78-08-0 Molecular Formula: C8H18O3Si Molecular Weight (g/mol): 190.31 MDL Number: MFCD00009063 InChI Key: FWDBOZPQNFPOLF-UHFFFAOYSA-N Synonym: vinyltriethoxysilane,triethoxyvinylsilane,silane, ethenyltriethoxy,triethoxy vinyl silane,polyscience vtes,triethoxyvinylsilicane,vtes,silane a 151,ethenyl triethoxy silane,silane, triethoxyvinyl PubChem CID: 6516 SMILES: CCO[Si](OCC)(OCC)C=C
| PubChem CID | 6516 |
|---|---|
| CAS | 78-08-0 |
| Molecular Weight (g/mol) | 190.31 |
| MDL Number | MFCD00009063 |
| SMILES | CCO[Si](OCC)(OCC)C=C |
| Synonym | vinyltriethoxysilane,triethoxyvinylsilane,silane, ethenyltriethoxy,triethoxy vinyl silane,polyscience vtes,triethoxyvinylsilicane,vtes,silane a 151,ethenyl triethoxy silane,silane, triethoxyvinyl |
| InChI Key | FWDBOZPQNFPOLF-UHFFFAOYSA-N |
| Molecular Formula | C8H18O3Si |
| Linear Formula | NaB(C2H5)3H |
|---|---|
| Molecular Weight (g/mol) | 121.99 |
| Color | Colorless |
| Physical Form | Solution |
| Chemical Name or Material | Sodium triethylborohydride |
| SMILES | [Na+].CC[BH-](CC)CC |
| InChI Key | YDTZLEUIYNMRLQ-UHFFFAOYSA-N |
| Density | 0.8900g/mL |
| PubChem CID | 23667700 |
| Name Note | 1M solution in THF |
| CAS | 109-99-9 |
| Health Hazard 3 | GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. IF ON SKIN (or hair): Take off immediately all contaminated clothing. Rinse skin with water/shower. Handle under inert gas. Protect from moisture |
| MDL Number | MFCD00011704 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May cause respiratory irritation. In contact with water releases flammable gas. Highly flammable liquid and vapor. May form explosive peroxides. Reacts violentl |
| Solubility Information | Solubility in water: rzacts. |
| Packaging | AcroSeal™ Glass bottle |
| Flash Point | −17°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | sodium triethylborohydride,sodium triethylborate,sodium triethylhydroborate,sodium triethylhydridoborate,sodium triethylhydroborate 1-,sodium triethylborohydride solution,sodium triethyl-? 2-boranuide,sodiumtriethylborohydride 1m in toluene |
| IUPAC Name | sodium;triethylboron(1-) |
| Molecular Formula | C6H16BNa |
| EINECS Number | 241-903-1 |
| Formula Weight | 121.99 |
| Specific Gravity | 0.89 |